5'-O-(Dimethoxytrityl)-N2-Benzyl-2'-deoxyguanosine
5'-O-(Dimethoxytrityl)-N2-Benzyl-2'-deoxyguanosine is a pivotal compound employed in the biomedical industry, finding its use in synthesizing nucleoside analogues and diverse pharmaceuticals. In the realm of medicine, it assumes the role of an intermediary component facilitating the research and development of therapeutic drugs aimed at research of viral infections and oncological afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 209785-64-8 |
| Pricing | Inquire |
| Cas | 209785-64-8 |
| Molecular Weight | 659.73 |
| Molecular Formula | C38H37N5O6 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(CC(O4)N5C=NC6=C5N=C(NC6=O)NCC7=CC=CC=C7)O |