Demethylmycophenolic acid-[d5]
Demethylmycophenolic acid-[d5], is the labelled analogue of Demethylmycophenolic acid, which is a metabolite of Mycophenolic acid. Mycophenolic acid is an immunosuppressant medication used to prevent rejection following organ transplantation and to treat Crohn's disease.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002483 |
| Pricing | Inquire |
| Cas | 1261432-41-0 |
| Molecular Weight | 311.34 |
| Molecular Formula | C16H13D5O6 |
| Canonical SMILES | CC1=C2COC(=O)C2=C(C(=C1O)CC=C(C)CCC(=O)O)O |