Erlotinib-[d4]
Erlotinib-[d4] is the labelled analogue of Erlotinib. Erlotinib is a tyrosine kinase inhibitor which acts on the epidermal growth factor receptor (EGFR), inhibiting EGFR-associated kinase activity. Erlotinib is a medication used to treat non-small cell lung cancer and pancreatic cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-005331 |
| Pricing | Inquire |
| Cas | 1130852-41-3 |
| Molecular Weight | 397.46 |
| Molecular Formula | C22H19D4N3O4 |
| Canonical SMILES | COCCOC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=CC(=C3)C#C)OCCOC |