AIM-100
AIM-100 is a small molecule inhibitor of Ack1. It not only inhibited Ack1 activation but also suppressed AKT tyrosine phosphorylation, leading to cell cycle arrest in the G1 phase. It could suppress AR Tyr(267) phosphorylation and its recruitment to the ATM enhancer and suppress pTyr267-AR phosphorylation, binding of AR to PSA, NKX3.1, and TMPRSS2 promoters, and inhibit AR transcription activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 873305-35-2 |
| Pricing | Inquire |
| Cas | 873305-35-2 |
| Molecular Weight | 371.43 |
| Molecular Formula | C23H21N3O2 |
| Canonical SMILES | C1CC(OC1)CNC2=C3C(=C(OC3=NC=N2)C4=CC=CC=C4)C5=CC=CC=C5 |