Glucotropaeolin potassium salt
Glucotropaeolin is a glucosinolate with antiprotozoal activity against HM1-IMSS E. histolytica, reducing the number of trophozoites (IC50 = 20.4 µg/ml). Glucotropaeolin does not have antitumor activity, but its metabolized isothiocyanate products have these activities. It may decrease spontaneous DNA damage in animals.
| Supplier | BOC Sciences |
|---|---|
| Product # | 5115-71-9 |
| Pricing | Inquire |
| Cas | 5115-71-9 |
| Molecular Weight | 447.52 |
| Molecular Formula | C14H18KNO9S2 |
| Canonical SMILES | C1=CC=C(C=C1)CC(=NOS(=O)(=O)[O-])SC2C(C(C(C(O2)CO)O)O)O.[K+] |