4,6-Di-O-acetyl-2,3-O-carbonyl-a-D-mannopyranosyl bromide
4,6-Di-O-acetyl-2,3-O-carbonyl-α-D-mannopyranosyl bromide, an indispensable compound within the biomedical sector, finds profound utility in the formation of glycoconjugates and glycosides. Its pivotal role as a primary reagent for the creation of pharmaceutical agents targeting a myriad of ailments, namely cancer, bacterial infections, and viral infections, cannot be overstated.
| Supplier | BOC Sciences |
|---|---|
| Product # | 53958-21-7 |
| Pricing | Inquire |
| Cas | 53958-21-7 |
| Molecular Weight | 353.12 |
| Molecular Formula | C11H13BrO8 |
| Canonical SMILES | CC(=O)OCC1C(C2C(C(O1)Br)OC(=O)O2)OC(=O)C |