LNA-G(dmf)-CE Phosphoramidite
LNA-G(dmf)-CE Phosphoramidite is a specialized nucleotide used in oligonucleotide synthesis. It features a locked nucleic acid (LNA) backbone with a guanine base modified with a dimethylformamide (dmf) group. Additionally, it contains a 5'-cyanoethyl (CE) phosphoramidite functionality for controlled addition during synthesis. LNAs are known for their enhanced hybridization properties and stability, and the dmf modification further enhances these characteristics. This phosphoramidite is valuable in molecular biology research for applications requiring high specificity and affinity, such as antisense oligonucleotide therapy, SNP detection, and diagnostic assays.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00390 |
| Pricing | Inquire |
| Cas | 709641-79-2 |
| Molecular Weight | 852.91 |
| Molecular Formula | C44H53N8O8P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C2C(OC1(CO2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)N6C=NC7=C6N=C(NC7=O)N=CN(C)C |