2-Chloro-6-ethoxyquinoline-3-carboxaldehyde
2-Chloro-6-ethoxyquinoline-3-carboxaldehyde (CAS# 281208-98-8) is a useful research chemical for the preparation of coumarin hydrazide-hydrazone derivatives as it is being studied and has shown to have antitumor activities against resistant pancreatic carcinoma (Panc-1), hepatocellular carcinoma (HepG2) and leukemia (CCRF) cell lines.
| Supplier | BOC Sciences |
|---|---|
| Product # | 281208-98-8 |
| Pricing | Inquire |
| Cas | 281208-98-8 |
| Molecular Weight | 235.67 |
| Molecular Formula | C12H10ClNO2 |
| Canonical SMILES | CCOC1=CC2=CC(=C(N=C2C=C1)Cl)C=O |