Propafenone Dimer Impurity-[d10]
Propafenone Dimer Impurity-[d10], is an isotope labelled derivative of Propafenone Dimer Impurity, which is an impurity of Propafenone. Propafenone is an anti-arrhythmic medication. It can be used for the treatment of illnesses associated with rapid heart beats such as atrial and ventricular arrhythmias.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-003902 |
| Pricing | Inquire |
| Cas | 1346602-27-4 |
| Molecular Weight | 633.64 |
| Molecular Formula | C39H35D10NO6 |
| Canonical SMILES | CCCN(CC(COC1=CC=CC=C1C(=O)CCC2=CC=CC=C2)O)CC(COC3=CC=CC=C3C(=O)CCC4=CC=CC=C4)O |