5'-O-DMT-N4-benzoyl-2'-fluoro-2'-deoxycytidine
5'-O-DMT-N4-benzoyl-2'-fluoro-2'-deoxycytidine boasts a promising pharmacological arsenal to combat a range of viral infections. With virucidal efficacy that targets the DNA replication machinery of several virus strains, the drug holds considerable therapeutic potential for cases of hepatitis B and C, as well as herpes and shingles. Furthermore, its anti-neoplastic properties make it a noteworthy exploratory tool for certain types of cancer treatment.
| Supplier | BOC Sciences |
|---|---|
| Product # | 146954-77-0 |
| Pricing | Inquire |
| Cas | 146954-77-0 |
| Molecular Weight | 651.68 |
| Molecular Formula | C37H34FN3O7 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(C(C(O4)N5C=CC(=NC5=O)NC(=O)C6=CC=CC=C6)F)O |