Scytalol A
It is produced by the strain of Scytalidium sp. 36-93. It selectively inhibits biosynthesis of dihydroxynaphthalene melanin in Lachnellula sp. A32-89, but does not inhibit the growth of the strain.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02891 |
| Pricing | Inquire |
| Cas | 208183-19-1 |
| Molecular Weight | 294.30 |
| Molecular Formula | C15H18O6 |
| Canonical SMILES | CC1(CC2C(CO1)C(=O)C3=C(C2O)C=C(C=C3O)OC)O |