Cholesterol β-D-Glucoside
Cholesterol β-D-glucoside is a derivative of cholesterol that contains β-D-glucose. It is formed from cholesterol and glucosylceramide by β-glucosidase 1. It is a lipid mediator in heat stress responses in animals, showing anti-ulcer effect. It activates heat shock transcription factor 1 (Hsf1) in response to heat shock, which increases the expression of heat shock protein 70 (Hsp70) in TIG-3 human fetal lung fibroblasts when used at a concentration of 10 µM.
| Supplier | BOC Sciences |
|---|---|
| Product # | BPG-3315 |
| Pricing | Inquire |
| Cas | 7073-61-2 |
| Molecular Weight | 548.79 |
| Molecular Formula | C33H56O6 |
| Canonical SMILES | CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC5C(C(C(C(O5)CO)O)O)O)C)C |