trans-Clopidogrel-MP Ethyl Ester-[13C,d3] Derivative (Mixture of Diastereomers)
trans-Clopidogrel-MP Ethyl Ester-[13C,d3] Derivative (Mixture of Diastereomers) is the labelled analogue of trans-Clopidogrel-MP Ethyl Ester Derivative (Mixture of Diastereomers), which is an intermediate in the preparation of Clopidogrel derivatives.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-006253 |
| Pricing | Inquire |
| Cas | 1331383-23-3 |
| Molecular Weight | 536.06 |
| Molecular Formula | C26[13C]H27D3ClNO6S |
| Canonical SMILES | CCOC(=O)C=C1CN(CCC1SCC(=O)C2=CC(=CC=C2)OC)C(C3=CC=CC=C3Cl)C(=O)OC |