L-Arginine-[1,2-13C2] hydrochloride
L-Arginine-[1,2-13C2] hydrochloride is the labelled analogue of L-Arginine hydrochloride. L-Arginine hydrochloride is the nitrogen donor for synthesis of nitric oxide, a potent vasodilator that is deficient during times of sickle cell crisis. Protein supplement in health care products.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-001673 |
| Pricing | Inquire |
| Cas | 201740-75-2 |
| Molecular Weight | 212.65 |
| Molecular Formula | C4[13C]2H14N4O2.HCl |
| Canonical SMILES | C(CC(C(=O)O)N)CN=C(N)N.Cl |