SLP120701 HCl
The hydrochloride salt form of SLP120701, an oxadiazol derivative, has been found to be a Sphk inhibitor and could probably be useful in studies of some cancer, fibrosis, and sickle cell diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1449768-46-0 |
| Pricing | Inquire |
| Cas | 1449768-46-0 |
| Molecular Weight | 391.94 |
| Molecular Formula | C20H30ClN5O |
| Canonical SMILES | N=C(N1[C@H](C2=NC(C3=CC=C(CCCCCCCC)C=C3)=NO2)CC1)N.[H]Cl |