Haloxyfop-[d4]
Haloxyfop-[d4], is the labelled analogue of Haloxyfop. Haloxyfop was originally produced as a racemic mixture for use as a herbicide for controlling grassy weeds. The compound is now available as the R-isomer, which is the herbicidally active one and is produced commercially as the methyl ester.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-000406 |
| Pricing | Inquire |
| Cas | 127893-34-9 |
| Molecular Weight | 365.72 |
| Molecular Formula | C15H7D4ClF3NO4 |
| Canonical SMILES | CC(C(=O)O)OC1=CC=C(C=C1)OC2=C(C=C(C=N2)C(F)(F)F)Cl |