ALB-109564
ALB 109564(a) is a semi-synthetic derivative of the vinka alkaloid vinblastine with potential antineoplastic activity. Tubulin inhibitor ALB 109564(a) binds to tubulin monomers and inhibits microtubule formation, resulting in disruption of mitotic spindle assembly and arrest of tumor cells in the G2/M phase of the cell cycle.
| Supplier | BOC Sciences |
|---|---|
| Product # | 854756-74-4 |
| Pricing | Inquire |
| Cas | 854756-74-4 |
| Molecular Weight | 857.07 |
| Molecular Formula | C47H60N4O9S |
| Canonical SMILES | CCC1(CC2CC(C3=C(CCN(C2)C1)C4=C(N3)C=CC(=C4)SC)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O |