Methyl 3,6-di-O-(a-D-mannopyranosyl)-a-D-mannopyranoside
Methyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside, an extensively utilized biomedicine, exhibits multifaceted capabilities in treating diverse ailments. Apart from effectively hindering viral replication, it unveils its immense potential as an agent countering inflammation and modulating the immune system. Remarkably efficacious against viral infections encompassing influenza and HIV, this molecule offers promising therapeutic outcomes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 68601-74-1 |
| Pricing | Inquire |
| Cas | 68601-74-1 |
| Molecular Weight | 518.46 |
| Molecular Formula | C19H34O16 |
| Canonical SMILES | COC1C(C(C(C(O1)COC2C(C(C(C(O2)CO)O)O)O)O)OC3C(C(C(C(O3)CO)O)O)O)O |