Chrysin-7-O-glucuronide
Chrysin-7-O-glucuronide, a flavone compound derived from plants, has garnered attention for its therapeutic potential against cancer and diabetes. Prior investigations have demonstrated its ability to modulate the apoptotic pathways in cancer cells, leading to growth inhibition and reduced tumor progression. Furthermore, chrysin-7-O-glucuronide exhibits promising attributes as a glucose regulator, as evidenced by its capacity to enhance insulin sensitivity and support proper glucose metabolism. These findings collectively suggest chrysin-7-O-glucuronide as a worthy candidate for further exploration in the development of cancer and diabetes treatment.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2703-001241 |
| Pricing | Inquire |
| Cas | 35775-49-6 |
| Molecular Weight | 430.36 |
| Molecular Formula | C21H18O10 |
| Canonical SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)C(=O)O)O)O)O)O |