Methyl 2- ((1R, 3R, 4''S, 5R, 5'S, 7R) - Dispiro[adamantane- 2, 3'- [1, 2, 4] trioxolane- 5', 1''- cyclohexan] - 4''- yl) acetate
Methyl 2- ((1R, 3R, 4''S, 5R, 5'S, 7R) - dispiro[adamantane- 2, 3'- [1, 2, 4] trioxolane- 5', 1''- cyclohexan] - 4''- yl) acetate is an intermediate for the synthesis of Arterolane p-Toluenesulfonic Acid (A614161), which is an antimalaria agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB058873 |
| Pricing | Inquire |
| Cas | 774597-73-8 |
| Molecular Weight | 336.42 |
| Molecular Formula | C19H28O5 |
| Canonical SMILES | COC(=O)CC1CCC2(CC1)OC3(C4CC5CC(C4)CC3C5)OO2 |