Finasteride EP Impurity B
An intermediate in the synthesis of Finasteride. Finasteride is a 4-azasteroid analog of testosterone that competitively blocks type II 5α-reductase activity with 100-fold greater affinity than for the type I enzyme.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2694-255935 |
| Pricing | Inquire |
| Cas | 103335-41-7 |
| Molecular Weight | 331.46 |
| Molecular Formula | C20H29NO3 |
| Canonical SMILES | CC12CCC3C(C1CCC2C(=O)OC)CCC4C3(C=CC(=O)N4)C |