Fmoc-Asp(OtBu)-OH-[15N]
Fmoc-Asp(OtBu)-OH-[15N] is the labelled analogue of Fmoc-L-aspartic acid β-tert-butyl ester. Fmoc-L-aspartic Acid β-tert-butyl Ester is Fmoc protected L-Aspartic Acid 4-tert-Butyl Ester which is a protected form of L-Aspartic acid. L-Aspartic acid is a nonessential amino acid that is used to biosynthesize other amino acids within the human body.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-000575 |
| Pricing | Inquire |
| Cas | 1217457-38-9 |
| Molecular Weight | 412.44 |
| Molecular Formula | C23H25[15N]O6 |
| Canonical SMILES | CC(C)(C)OC(=O)CC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |