Boc-Phe-(Alloc)Lys-PAB-PNP
Boc-Phe-(Alloc)Lys-PAB-PNP is a complex biomedical compound being investigated as an innovative treatment for a variety of diseases, especially cancer. Known for its powerful properties, it effectively halts tumor progression through targeted neutralization of unique enzymes and pathways.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-00490 |
| Pricing | Inquire |
| Cas | 1160844-44-9 |
| Molecular Weight | 747.79 |
| Molecular Formula | C38H45N5O11 |
| Canonical SMILES | CC(C)(C)OC(=O)NC(CC1=CC=CC=C1)C(=O)N(C2=CC=C(C=C2)COC(=O)OC3=CC=C(C=C3)[N+](=O)[O-])C(CCCCNC(=O)OCC=C)C(=O)N |