2-(4-Biphenylyl)-6-phenylbenzoxazole
2-(4-Biphenylyl)-6-phenylbenzoxazole is a highly versatile compound extensively employed in the biomedical sector. It demonstrates remarkable efficacy in suppressing the growth of diverse cancer cell strains, thereby exhibiting its profound promise as a potential pharmaceutical agent for cancer therapy. Furthermore, its notable antifungal characteristics enable it to effectively combat fungal infections. Consequently, this product exhibits tremendous prospects in drug discovery endeavors and therapeutic interventions targeting oncological disorders and infectious maladies alike.
| Supplier | BOC Sciences |
|---|---|
| Product # | 17064-47-0 |
| Pricing | Inquire |
| Cas | 17064-47-0 |
| Molecular Weight | 347.417 |
| Molecular Formula | C25H17NO |
| Canonical SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NC4=C(O3)C=C(C=C4)C5=CC=CC=C5 |