BDP TR alkyne
BDP TR is a borondipyrromethene fluorophore for ROX (Texas Red) channel. This is a universal fluorophore that can be used for microscopy, fluorescence polarization assay, and other applications. This derivative is a terminal alkyne for copper-catalyzed Click chemistry.
| Supplier | BOC Sciences |
|---|---|
| Product # | R02-0019 |
| Pricing | Inquire |
| Cas | 2006345-35-1 |
| Molecular Weight | 461.29 |
| Molecular Formula | C24H18N3BF2O2S |
| Canonical SMILES | [B-]1(N2C(=CC=C2C3=CC=CS3)C=C4[N+]1=C(C=C4)C5=CC=C(C=C5)OCC(=O)NCC#C)(F)F |