2-Demethoxy-4-methoxy Urapidil-[d4]
2-Demethoxy-4-methoxy Urapidil-[d4], is the labelled analogue of 2-Demethoxy-4-methoxy Urapidil, which is an impurity of Urapidil. Urapidil is a sympatholytic antihypertensive drug. It acts as an α1-adrenoceptor antagonist and as a 5-HT1A receptor agonist.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002057 |
| Pricing | Inquire |
| Cas | 1794780-14-5 |
| Molecular Weight | 391.5 |
| Molecular Formula | C20H25D4N5O3 |
| Canonical SMILES | CN1C(=CC(=O)N(C1=O)C)NCCCN2CCN(CC2)C3=CC=C(C=C3)OC |