Methyl 2-O-a-L-fucopyranosyl-b-D-galactoside
Methyl 2-O-a-L-fucopyranosyl-b-D-galactoside is a compound of utmost importance in the biomedical sector with extensive employment in the synthesis and development of potential antitumor compounds and anti-inflammatory medications. Furthermore, this compound aids in studying for disorders associated with carbohydrate metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 37288-45-2 |
| Pricing | Inquire |
| Cas | 37288-45-2 |
| Molecular Weight | 340.32 |
| Molecular Formula | C13H24O10 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(C(C(OC2OC)CO)O)O)O)O)O |