4-Desacetamido-4-chloro Andarine
4-Desacetamido-4-chloro Andarine is a Selective Androgen Receptor Modulator (SARM) that has potential use for treatment of androgen related diseases such as muscle wasting and osteoporosis. 4-Desacetamido-4-chloro Andarine also a derivative of Andarine (A637470), a non-steroidal SARM that is used by athletes to enhance performance.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB068454 |
| Pricing | Inquire |
| Cas | 541497-92-1 |
| Molecular Weight | 418.75 |
| Molecular Formula | C17H14ClF3N2O5 |
| Canonical SMILES | CC(COC1=CC=C(C=C1)Cl)(C(=O)NC2=CC(=C(C=C2)[N+](=O)[O-])C(F)(F)F)O |