RF 9
RF 9 is a potent and selective Neuropeptide FF receptor antagonist, with Kis of 58±5 and 75±9 nM for hNPFF1R and hNPFF2R, respectively. It displays selectivity over several related receptors including NPY Y1 GPR10, GPR54, GPR103 and the opioid receptors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 876310-60-0 |
| Pricing | Inquire |
| Cas | 876310-60-0 |
| Molecular Weight | 482.62 |
| Molecular Formula | C26H38N6O3 |
| Canonical SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC4=CC=CC=C4)C(=O)N |