Erythromycin B
Erythromycin B is a minor co-metabolite of erythromycin produced by fermentation of Saccharopolyspora erythreae. Erythromycin B exhibits broad spectrum antibiotic activity against Gram-positive and Gram-negative bacteria. An impurity of Erythromycin.
| Supplier | BOC Sciences |
|---|---|
| Product # | 527-75-3 |
| Pricing | Inquire |
| Cas | 527-75-3 |
| Molecular Weight | 717.93 |
| Molecular Formula | C37H67NO12 |
| Canonical SMILES | CCC1C(C(C(C(=O)C(CC(C(C(C(C(C(=O)O1)C)OC2CC(C(C(O2)C)O)(C)OC)C)OC3C(C(CC(O3)C)N(C)C)O)(C)O)C)C)O)C |