Riviciclib HCl
Riviciclib, also known as P276-00, is a novel CDK1, CDK4 and CDK9 inhibitor with IC50 of 79 nM, 63 nM and 20 nM, respectively. P276-00 selectively binds to and inhibits Cdk4/cyclin D1, Cdk1/cyclin B and Cdk9/cyclin T1, serine/threonine kinases that play key roles in the regulation of the cell cycle and cellular proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 920113-03-7 |
| Pricing | Inquire |
| Cas | 920113-03-7 |
| Molecular Weight | 438.3 |
| Molecular Formula | C21H21Cl2NO5 |
| Canonical SMILES | O=C1C=C(C2=CC=CC=C2Cl)OC3=C1C(O)=CC(O)=C3[C@H]4[C@H](CO)N(C)CC4.[H]Cl |