(S)-4-methyl-N-(3-(4-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)phenyl)-2-(pyrimidin-5-yl)-1,2,3,4-tetrahydroisoquinoline-7-carboxamide
(S)-4-methyl-N-(3-(4-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)phenyl)-2-(pyrimidin-5-yl)-1,2,3,4-tetrahydroisoquinoline-7-carboxamide is an effective Erv1/ALR inhibitor with IC50 values of 900 nM and 700 nM, respectively. It also inhibits Erv2 (IC50 = 1.4 μM) and can induce apoptosis of hESCs cells through the release of cytochrome c.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1934246-20-4 |
| Pricing | Inquire |
| Cas | 1934246-20-4 |
| Molecular Weight | 492.5 |
| Molecular Formula | C26H23F3N6O |
| Canonical SMILES | O=C(NC=1C=C(C=C(C1)C(F)(F)F)N2C=NC(=C2)C)C3=CC=C4C(=C3)CN(C=5C=NC=NC5)CC4C |