Aldosterone-[9,11,12,12-d4]
Aldosterone-[d4] is the deuterium labelled analog of Aldosterone. Aldosterone, the main mineralocorticoid hormone, is a steroid hormone produced by the zona glomerulosa of the adrenal cortex in the adrenal gland. It is essential for sodium conservation in the kidney, salivary glands, sweat glands and colon.
Supplier | BOC Sciences |
---|---|
Product # | BLP-007179 |
Pricing | Inquire |
Molecular Weight | 364.50 |
Molecular Formula | C21H28D4O5 |
Canonical SMILES | CC12CCC(=O)C=C1CCC3C2C4CC5(C3CCC5C(=O)CO)C(O4)O |