Fulvic acid
Fulvic acid, a potent organic compound, is utilized in biomedicine for its efficacy in improving drug transportation within the body. This multifunctional substance exhibits anti-inflammatory effects, particularly beneficial in the treatment of conditions such as arthritis and inflammatory bowel disease. Furthermore, its antioxidant capabilities play a crucial role in accelerating the healing process of wounds.
| Supplier | BOC Sciences |
|---|---|
| Product # | 479-66-3 |
| Pricing | Inquire |
| Cas | 479-66-3 |
| Molecular Weight | 308.24 |
| Molecular Formula | C14H12O8 |
| Canonical SMILES | CC1(CC2=C(CO1)C(=O)C3=C(C(=C(C=C3O2)O)O)C(=O)O)O |