Hydroxytyrosol Acetate
Hydroxytyrosol acetate is a phenol isolated from canarium album. It has neuroprotective, anti-inflammatory, antibacterial ansd antioxidant effects. It can improve the oxidative events and return pro-inflammatory proteins expression to basal levels.
| Supplier | BOC Sciences |
|---|---|
| Product # | 69039-02-7 |
| Pricing | Inquire |
| Cas | 69039-02-7 |
| Molecular Weight | 196.20 |
| Molecular Formula | C10H12O4 |
| Canonical SMILES | CC(=O)OCCC1=CC(=C(C=C1)O)O |