17α-Estradiol Sulfate Sodium Salt
A derivative of Estradiol. Estradiol is the major estrogen secreted by the premenopausal ovary. Estrogens direct the development of the female genotype in embryogenesis and at puberty.
| Supplier | BOC Sciences |
|---|---|
| Product # | 56050-04-5 |
| Pricing | Inquire |
| Cas | 56050-04-5 |
| Molecular Weight | 351.45 22.99 |
| Molecular Formula | C18H23O5S . Na |
| Canonical SMILES | CC12CCC3C(C1CCC2O)CCC4=C3C=CC(=C4)OS(=O)(=O)[O-].[Na+] |