3',5'-O-(1,1,3,3-Tetraisopropyl-1,3-disiloxanediyl)adenosine
3',5'-O-(1,1,3,3-Tetraisopropyl-1,3-disiloxanediyl)adenosine is a novel compound utilized in the biomedical industry. It exhibits potential therapeutic effects in the treatment of diseases involving adenosine receptors such as cancer, cardiovascular disorders, and neurological conditions. Through its unique chemical structure, this compound acts as a modulator of adenosine signaling pathways, offering new avenues for drug development and research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 69304-45-6 |
| Pricing | Inquire |
| Cas | 69304-45-6 |
| Molecular Weight | 509.76 |
| Molecular Formula | C22H39N5O5Si2 |
| Canonical SMILES | CC(C)[Si]1(OCC2C(C(C(O2)N3C=NC4=C(N=CN=C43)N)O)O[Si](O1)(C(C)C)C(C)C)C(C)C |