2,3,5-Tri-O-benzyl-b-D-ribofuranose
2,3,5-Tri-O-benzyl-b-D-ribofuranose is a key compound extensively employed in biomedicine. It acts as a crucial building block for the synthesis of nucleosides, nucleotides, and glycosides. This versatile compound finds applications in drug development. It plays an essential role in the production of effective pharmaceutical therapies targeting these medical conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 89361-52-4 |
| Pricing | Inquire |
| Cas | 89361-52-4 |
| Molecular Weight | 420.51 |
| Molecular Formula | C26H28O5 |
| Canonical SMILES | C1=CC=C(C=C1)COCC2C(C(C(O2)O)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |