Cyanidin-3-O-lathyroside chloride
Cyanidin-3-O-lathyroside chloride is a remarkable biomedical compound, renowned for its substantial antioxidant and anti-inflammatory attributes. This compound is used for studying oxidative stress-mediated conditions like neurodegenerative disorders and cardiovascular diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 31073-32-2 |
| Pricing | Inquire |
| Cas | 31073-32-2 |
| Molecular Weight | 616.95 |
| Molecular Formula | C26H29O15 Cl |
| Canonical SMILES | C1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC4=C(C=C(C=C4[O+]=C3C5=CC(=C(C=C5)O)O)O)O)CO)O)O)O)O)O.[Cl-] |