Cefodizime sodium
Cefodizime sodium, an antibiotic renowned for its efficacy in combating diverse bacterial infections such as those affecting the lower respiratory tract, skin and soft tissues, and urinary tract, functions through the inhibition of bacterial cell wall formation, ultimately culminating in the cessation of bacterial cell viability.
| Supplier | BOC Sciences |
|---|---|
| Product # | 86329-79-5 |
| Pricing | Inquire |
| Cas | 86329-79-5 |
| Molecular Weight | 628.64 |
| Molecular Formula | C20H18N6Na2O7S4 |
| Canonical SMILES | CC1=C(SC(=N1)SCC2=C(N3C(C(C3=O)NC(=O)C(=NOC)C4=CSC(=N4)N)SC2)C(=O)[O-])CC(=O)[O-].[Na+].[Na+] |