Oncrasin-1
Oncrasin-1 is a potent and effective anticancer inhibitor that kills various human lung cancer cells with K-Ras mutations at low or submicromolar concentrations. It also led to abnormal aggregation of PKCĪ¹ in nucleus of sensitive cells but not in resistant cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-379298 |
| Pricing | 50 mg/unit USD $298 |
| Cas | 75629-57-1 |
| Molecular Weight | 269.73 |
| Molecular Formula | C16H12ClNO |
| Canonical SMILES | C1=CC=C2C(=C1)C(=CN2CC3=CC=C(C=C3)Cl)C=O |