Potassium 3,5-dimethylisoxazole-4-trifluoroborate
Potassium 3,5-dimethylisoxazole-4-trifluoroborate is an influential compound in the field of biomedicine. Its indispensability arises from its pivotal involvement in the synthesis of targeted drugs, focusing on the combat against cancer and infectious diseases. Displaying remarkable attributes of binding, this compound serves as a noteworthy intermediary, fueling the advancement of cutting-edge therapeutic solutions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1111732-84-3 |
| Pricing | Inquire |
| Cas | 1111732-84-3 |
| Molecular Weight | 203.01 |
| Molecular Formula | C5H6BF3KNO |
| Canonical SMILES | [B-](C1=C(ON=C1C)C)(F)(F)F.[K+] |