Psidial A
Psidial A, a natural triterpenoid isolated from the leaves of Psidium guajava L, exhibits the activity to enzyme PTP1B and also reduces tumor growth and stimulates uterus proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2703-189343 |
| Pricing | 5 mg/unit USD $1999 |
| Cas | 1207181-35-8 |
| Molecular Weight | 474.6 |
| Molecular Formula | C30H34O5 |
| Canonical SMILES | CC1(CC2C1CCC3(C(CCC2=C)C(C4=C(C(=C(C(=C4O3)C=O)O)C=O)O)C5=CC=CC=C5)C)C |