4-Methoxy Retinoic Acid Methyl Ester
4-Methoxy Retinoic Acid Methyl Ester is an impurity of Retinoic acid. Retinoic Acid is a metabolite of Vitamin A and ajusts its functions of cellular growth and differentiation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 163808-81-9 |
| Pricing | Inquire |
| Cas | 163808-81-9 |
| Molecular Weight | 344.49 |
| Molecular Formula | C22H32O3 |
| Canonical SMILES | CC1=C(C(CCC1OC)(C)C)C=CC(=CC=CC(=CC(=O)OC)C)C |