1-O-Acetyl-2,5-di-O-benzoyl-3-fluoro-3-deoxy-D-ribofuranoside
Utilized within the field of biomedicine, 1-O-Acetyl-2,5-di-O-benzoyl-3-fluoro-3-deoxy-D-ribofuranoside is a compound that investigates the metabolism and antiviral potency of nucleosides. With demonstrated effectiveness against HIV-1, hepatitis B, and varicella-zoster virus, this compound exhibits promise as a therapeutic option within antiviral research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 123484-12-8 |
| Pricing | Inquire |
| Cas | 123484-12-8 |
| Molecular Weight | 402.37 |
| Molecular Formula | C21H19FO7 |
| Canonical SMILES | CC(=O)OC1C(C(C(O1)COC(=O)C2=CC=CC=C2)F)OC(=O)C3=CC=CC=C3 |