Bis(2-nitrophenyl) disulfide
Bis(2-nitrophenyl) disulfide (CAS# 1155-00-6) is also a building block used for the synthesis of various pharmaceutical compounds. It can be used for the preparation of a series of 4-Azaindole inhibitors of c-Met kinase.
Supplier | BOC Sciences |
---|---|
Product # | 1155-00-6 |
Pricing | Inquire |
Cas | 1155-00-6 |
Molecular Weight | 308.33 |
Molecular Formula | C12H8N2O4S2 |
Canonical SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])SSC2=CC=CC=C2[N+](=O)[O-] |