Rp-8-Br-PET-cGMPS
Rp-8-Br-PET-cGMPS is a selective inhibitor of cGMP-dependent protein kinase I a and I β and of retinal cGMP-gated ion channels. It effects against mammalian cyclic nucleotide-dependent phosphodiesterases. Compared to Rp-8-pCPT-cGMPS, it is much more lipophilic and membrane-permeant.
| Supplier | BOC Sciences |
|---|---|
| Product # | 172806-20-1 |
| Pricing | Inquire |
| Cas | 172806-20-1 |
| Molecular Weight | 562.3 |
| Molecular Formula | C18H14BrN5O6PS · Na |
| Canonical SMILES | C1C2C(C(C(O2)N3C4=C(C(=O)N5C=C(NC5=N4)C6=CC=CC=C6)N=C3Br)O)OP(=S)(O1)[O-].[Na+] |