Cytidine-5'-O-(1-Thiotriphosphate)
Cytidine-5'-O-(1-Thiotriphosphate) is a crucial reagent extensively employed in the biomedicine sector. It is widely used in the field of molecular biology for studying cellular processes like RNA synthesis and protein translation. Additionally, this compound is utilized in research focused on the analysis of nucleotide sequences and studying the role of RNA enzymes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 118353-34-7 |
| Pricing | Inquire |
| Cas | 118353-34-7 |
| Molecular Weight | 587.15 |
| Molecular Formula | C9H12N3Na4O13P3S |
| Canonical SMILES | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=S)(O)OP(=O)(O)OP(=O)(O)O)O)O |