Man-9 N-Glycan
Man-9 N-Glycan is a highly intricate polysaccharide arrangement, finding significant applications for exploring the intricate nature of glycoproteins. Comprising a chain of nine mannose residues, this complex carbohydrate structure assumes a pivotal function in the realms of protein folding, stability and recognition mechanisms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 71246-55-4 |
| Pricing | Inquire |
| Cas | 71246-55-4 |
| Molecular Weight | 1883.67 |
| Molecular Formula | C70H118N2O56 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC(C(CO)O)C(C(C=O)NC(=O)C)O)CO)OC2C(C(C(C(O2)COC3C(C(C(C(O3)COC4C(C(C(C(O4)CO)O)O)OC5C(C(C(C(O5)CO)O)O)O)O)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)CO)O)O)O)O)O)OC8C(C(C(C(O8)CO)O)O)OC9C(C(C(C(O9)CO)O)O)OC1C(C(C(C(O1)CO)O)O)O)O)O |