(9E)-12-Hydroxy-9-octadecenoic acid
(9E)-12-Hydroxy-9-octadecenoic acid is utilized extensively within the pharmaceutical sector for the synthesis of medications targeted towards combatting inflammation and autoimmune ailments. Functioning as a key precursor in the creation of lipoxins, renowned for their potent anti-inflammatory attributes and integral involvement in modulating immune reactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 82188-83-8 |
| Pricing | Inquire |
| Cas | 82188-83-8 |
| Molecular Weight | 298.46 |
| Molecular Formula | C18H34O3 |
| Canonical SMILES | CCCCCCC(CC=CCCCCCCCC(=O)O)O |